ǣ
  gw
N-BOC-3-ͪ
N-BOC-3-ऴ
4,4-ͪ
3-ȼ׻-1,2,4--5-ͪ
3--2-
1-(3-)
2--1,1,1-
  ԭˎ
̩ù
Z
h
}Īɳ
̹
ӷ
c
ǰλã >> aƷB  
3--2-
ӢQ 3-acetyl-2-chloropyridine
Ąe 2--3-;1-(2--3-ऻ)-1-ͪ
ӢĄe Ethanone,1-(2-chloro-3-pyridinyl)-;1-(2-chloro-3-pyridyl)ethanone
CAS ̖ 55676-21-6
155.5816
ʽ C7H6ClNO
InChI InChI=1/C7H6ClNO/c1-5(10)6-3-2-4-9-7(6)8/h2-4H,1H3
Y ʽ
ܡȣ 1.233g/cm3
Сc 231.986C at 760 mmHg
Wc 94.102C
| ˾ | aƷB | ھӆ | “ϵ҂ | ENGLISH
}ˎƷ_l޹˾ (C)2011 Wj֧ ЇW ȫ򻯹W
ձav߹ۿ벻_պavӰ_ղĻ߹ۿ